Monomers

Methacrylic acid

Identifiers

IUPAC name
2-methylprop-2-enoic acid
InchI
InChI=1S/C4H6O2/c1-3(2)4(5)6/h1H2,2H3,(H,5,6)
InchI Key
CERQOIWHTDAKMF-UHFFFAOYSA-N
SMILES
CC(=C)C(=O)O
Canonical SMILES
CC(=C)C(=O)O
Isomeric SMILES
CC(=C)C(=O)O
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C4H6O2
Heavy Atom Count
6
Molecular Weight
86.09
Exact Molecular Weight
86.0368
Valence Electrons
34
Radical Electrons
0
tPSA
37.3
MolLogP
0.6471
H Bond Acceptors
1
H Bond Donors
1
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 12 11  0  0  0  0  0  0  0  0999 V2000
   -1.3024   -0.8012    0.3824 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2067    0.1048   -0.0544 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4777    1.1629   -0.8201 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1395   -0.1962    0.3723 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3816   -1.1765    1.0802 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.2206    0.6196   -0.0054 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1981   -0.1651    0.5227 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0487   -1.3628    1.2867 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4983   -1.5141   -0.4418 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4827    1.3921   -1.1418 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3573    1.7853   -1.1065 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1156    0.1511   -0.0743 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  3
  2  4  1  0
  4  5  2  0
  4  6  1  0
  1  7  1  0
  1  8  1  0
  1  9  1  0
  3 10  1  0
  3 11  1  0
  6 12  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers