Monomers

Methyl methacrylate

Identifiers

IUPAC name
methyl 2-methylprop-2-enoate
InchI
InChI=1S/C5H8O2/c1-4(2)5(6)7-3/h1H2,2-3H3
InchI Key
VVQNEPGJFQJSBK-UHFFFAOYSA-N
SMILES
COC(=O)C(=C)C
Canonical SMILES
CC(=C)C(=O)OC
Isomeric SMILES
CC(=C)C(=O)OC
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C5H8O2
Heavy Atom Count
7
Molecular Weight
100.117
Exact Molecular Weight
100.0524
Valence Electrons
40
Radical Electrons
0
tPSA
26.3
MolLogP
0.7355
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 15 14  0  0  0  0  0  0  0  0999 V2000
    2.6892    0.3374   -0.4995 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4600    0.2789    0.1980 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.2620   -0.0458   -0.3663 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2355   -0.3149   -1.5963 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9683   -0.0859    0.4180 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9201    0.1967    1.6937 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2759   -0.4398   -0.1959 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2709   -0.5946   -0.3265 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2803    1.1673   -0.0428 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5714    0.5474   -1.5649 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0169    0.4528    2.1451 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8169    0.1706    2.2798 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1469   -1.2348   -0.9861 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9628   -0.8870    0.5542 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6953    0.4520   -0.6835 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  2  3
  5  7  1  0
  1  8  1  0
  1  9  1  0
  1 10  1  0
  6 11  1  0
  6 12  1  0
  7 13  1  0
  7 14  1  0
  7 15  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers