Monomers

Ethyl methacrylate

Identifiers

IUPAC name
ethyl 2-methylprop-2-enoate
InchI
InChI=1S/C6H10O2/c1-4-8-6(7)5(2)3/h2,4H2,1,3H3
InchI Key
SUPCQIBBMFXVTL-UHFFFAOYSA-N
SMILES
CCOC(=O)C(=C)C
Canonical SMILES
CCOC(=O)C(=C)C
Isomeric SMILES
CCOC(=O)C(=C)C
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C6H10O2
Heavy Atom Count
8
Molecular Weight
114.144
Exact Molecular Weight
114.0681
Valence Electrons
46
Radical Electrons
0
tPSA
26.3
MolLogP
1.1256
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 18 17  0  0  0  0  0  0  0  0999 V2000
    2.5163   -0.1688    0.9659 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0325   -0.6869   -0.3679 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6405   -0.7214   -0.4727 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1064    0.4394   -0.3472 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5290    1.5021   -0.1381 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5752    0.4294   -0.4537 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2647    1.5458   -0.3309 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2667   -0.8588   -0.7016 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4824   -0.6391    1.2579 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7117    0.9197    0.8829 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8094   -0.3591    1.7837 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5323   -0.1286   -1.1942 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4016   -1.7394   -0.4662 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3395    1.5041   -0.4141 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8075    2.4933   -0.1523 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5561   -1.5326   -1.2076 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5639   -1.3005    0.2765 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1757   -0.6985   -1.3242 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  3
  6  8  1  0
  1  9  1  0
  1 10  1  0
  1 11  1  0
  2 12  1  0
  2 13  1  0
  7 14  1  0
  7 15  1  0
  8 16  1  0
  8 17  1  0
  8 18  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers