Monomers

Isobutyl methacrylate

Identifiers

IUPAC name
2-methylpropyl 2-methylprop-2-enoate
InchI
InChI=1S/C8H14O2/c1-6(2)5-10-8(9)7(3)4/h6H,3,5H2,1-2,4H3
InchI Key
RUMACXVDVNRZJZ-UHFFFAOYSA-N
SMILES
CC(COC(=O)C(=C)C)C
Canonical SMILES
CC(C)COC(=O)C(=C)C
Isomeric SMILES
CC(C)COC(=O)C(=C)C
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C8H14O2
Heavy Atom Count
10
Molecular Weight
142.198
Exact Molecular Weight
142.0994
Valence Electrons
58
Radical Electrons
0
tPSA
26.3
MolLogP
1.7617
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 24 23  0  0  0  0  0  0  0  0999 V2000
    2.4860   -0.4196    0.5983 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9229    0.8888    0.1018 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6893    0.7067   -0.7312 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3531    0.0678   -0.0061 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5487   -0.1437   -0.7104 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6551    0.2223   -1.9068 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6727   -0.7834   -0.0738 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7884   -0.9808   -0.7308 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5723   -1.2224    1.3310 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9831    1.5157   -0.7885 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5363   -0.2155    0.9274 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5535   -1.1814   -0.2021 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9401   -0.7824    1.4945 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.7475    1.5381    0.9619 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9029    0.1078   -1.6262 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3062    1.7316   -0.9685 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8830   -0.6660   -1.7631 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.6499   -1.4638   -0.2643 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4208   -1.8591    1.6398 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6233   -0.2925    1.9705 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5861   -1.7096    1.5522 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8263    1.0791   -1.8063 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8482    2.6135   -0.8200 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0112    1.2490   -0.4330 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  2  3
  7  9  1  0
  2 10  1  0
  1 11  1  0
  1 12  1  0
  1 13  1  0
  2 14  1  0
  3 15  1  0
  3 16  1  0
  8 17  1  0
  8 18  1  0
  9 19  1  0
  9 20  1  0
  9 21  1  0
 10 22  1  0
 10 23  1  0
 10 24  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers