Monomers

Glycidyl methacrylate

Identifiers

IUPAC name
oxiran-2-ylmethyl 2-methylprop-2-enoate
InchI
InChI=1S/C7H10O3/c1-5(2)7(8)10-4-6-3-9-6/h6H,1,3-4H2,2H3
InchI Key
VOZRXNHHFUQHIL-UHFFFAOYSA-N
SMILES
CC(=C)C(=O)OCC1CO1
Canonical SMILES
CC(=C)C(=O)OCC1CO1
Isomeric SMILES
CC(=C)C(=O)OCC1CO1
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C7H10O3
Heavy Atom Count
10
Molecular Weight
142.154
Exact Molecular Weight
142.063
Valence Electrons
56
Radical Electrons
0
tPSA
38.83
MolLogP
0.5045
H Bond Acceptors
3
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
1
Aromatic Heterocycles
0
Aliphatic Rings
1
Aromatic Rings
0

MOL File


     RDKit          3D

 20 20  0  0  0  0  0  0  0  0999 V2000
    2.4716    1.3936    0.0293 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1280   -0.0453   -0.0702 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0794   -0.9262    0.1310 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7600   -0.4399   -0.3848 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4445   -1.6583   -0.4746 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2290    0.4908   -0.5937 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5693    0.1681   -0.9009 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2000   -0.6496    0.1733 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2798   -0.0374    0.9646 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5317   -1.0285   -0.0249 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5371    2.0229   -0.0166 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9556    1.6362    0.9865 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0692    1.6858   -0.8609 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8541   -1.9772    0.0641 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0775   -0.6193    0.3609 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6336   -0.3014   -1.9097 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1139    1.1295   -0.9858 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5912   -1.4227    0.6874 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5641   -0.4015    1.9711 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6644    0.9805    0.6917 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  3
  2  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  1  0
  9 10  1  0
 10  8  1  0
  1 11  1  0
  1 12  1  0
  1 13  1  0
  3 14  1  0
  3 15  1  0
  7 16  1  0
  7 17  1  0
  8 18  1  0
  9 19  1  0
  9 20  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers