Monomers

Butyl methacrylate

Identifiers

IUPAC name
butyl 2-methylprop-2-enoate
InchI
InChI=1S/C8H14O2/c1-4-5-6-10-8(9)7(2)3/h2,4-6H2,1,3H3
InchI Key
SOGAXMICEFXMKE-UHFFFAOYSA-N
SMILES
CCCCOC(=O)C(=C)C
Canonical SMILES
CCCCOC(=O)C(=C)C
Isomeric SMILES
CCCCOC(=O)C(=C)C
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C8H14O2
Heavy Atom Count
10
Molecular Weight
142.198
Exact Molecular Weight
142.0994
Valence Electrons
58
Radical Electrons
0
tPSA
26.3
MolLogP
1.9058
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 24 23  0  0  0  0  0  0  0  0999 V2000
   -3.1726    1.2202   -0.2881 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1104    0.4979    0.5054 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8276   -0.8127   -0.1901 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7845   -1.5694    0.5505 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4564   -0.9224    0.6811 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2120   -0.5589   -0.4224 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7586   -0.8250   -1.5641 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.5031    0.1161   -0.2878 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1748    0.4368   -1.3615 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0652    0.4442    1.0560 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6804    1.9356   -0.9899 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.8002    1.7792    0.4357 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7720    0.4817   -0.8220 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4239    0.3760    1.5406 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1825    1.1076    0.4781 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5287   -0.6748   -1.2352 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7521   -1.4456   -0.2094 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5683   -2.5434    0.0208 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1415   -1.8187    1.5767 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7749    0.2032   -2.3255 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1227    0.9315   -1.2924 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0824   -0.0014    1.0769 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4341    0.0836    1.8728 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1604    1.5588    1.1940 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  2  3
  8 10  1  0
  1 11  1  0
  1 12  1  0
  1 13  1  0
  2 14  1  0
  2 15  1  0
  3 16  1  0
  3 17  1  0
  4 18  1  0
  4 19  1  0
  9 20  1  0
  9 21  1  0
 10 22  1  0
 10 23  1  0
 10 24  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers