Monomers

Vinylidene chloride

Identifiers

IUPAC name
1,1-dichloroethene
InchI
InChI=1S/C2H2Cl2/c1-2(3)4/h1H2
InchI Key
LGXVIGDEPROXKC-UHFFFAOYSA-N
SMILES
ClC(=C)Cl
Canonical SMILES
C=C(Cl)Cl
Isomeric SMILES
C=C(Cl)Cl
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C2H2Cl2
Heavy Atom Count
4
Molecular Weight
96.944
Exact Molecular Weight
95.9534
Valence Electrons
24
Radical Electrons
0
tPSA
0.0
MolLogP
1.9352
H Bond Acceptors
0
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

  6  5  0  0  0  0  0  0  0  0999 V2000
    0.3867   -1.7965   -1.0133 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.1949   -0.1324   -0.4989 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2758    0.1677    0.7059 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6415    1.1401   -1.6190 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   -0.3843    1.2045    0.9985 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5630   -0.5833    1.4268 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  3
  2  4  1  0
  3  5  1  0
  3  6  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers