Monomers

1,4-Divinylbenzene

Identifiers

IUPAC name
1,4-bis(ethenyl)benzene
InchI
InChI=1S/C10H10/c1-3-9-5-7-10(4-2)8-6-9/h3-8H,1-2H2
InchI Key
WEERVPDNCOGWJF-UHFFFAOYSA-N
SMILES
C=Cc1ccc(cc1)C=C
Canonical SMILES
C=CC1=CC=C(C=C1)C=C
Isomeric SMILES
C=CC1=CC=C(C=C1)C=C
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C10H10
Heavy Atom Count
10
Molecular Weight
130.19
Exact Molecular Weight
130.0783
Valence Electrons
50
Radical Electrons
0
tPSA
0.0
MolLogP
2.9726
H Bond Acceptors
0
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
1
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
1

MOL File


     RDKit          3D

 20 20  0  0  0  0  0  0  0  0999 V2000
    3.1550    1.3833   -1.3930 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6043    1.1713   -0.2219 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2823    0.5817   -0.0509 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5480    0.2179   -1.1508 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7218   -0.3485   -0.9826 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2366   -0.5420    0.2741 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4556   -0.1574    1.3671 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7880    0.3980    1.2254 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5583   -1.1304    0.4939 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3048   -1.4970   -0.5179 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1481    1.8287   -1.4388 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7189    1.1578   -2.3537 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1661    1.4514    0.6737 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8905    0.3408   -2.1780 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2737   -0.6239   -1.8763 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8637   -0.3104    2.3763 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3727    0.6880    2.1127 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9249   -1.2642    1.5274 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2779   -1.9286   -0.3068 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0568   -1.4166   -1.5553 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  6  9  1  0
  9 10  2  3
  8  3  1  0
  1 11  1  0
  1 12  1  0
  2 13  1  0
  4 14  1  0
  5 15  1  0
  7 16  1  0
  8 17  1  0
  9 18  1  0
 10 19  1  0
 10 20  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers