Monomers

2-Methyl-5-vinylpyridine

Identifiers

IUPAC name
5-ethenyl-2-methylpyridine
InchI
InChI=1S/C8H9N/c1-3-8-5-4-7(2)9-6-8/h3-6H,1H2,2H3
InchI Key
VJOWMORERYNYON-UHFFFAOYSA-N
SMILES
C=Cc1ccc(nc1)C
Canonical SMILES
CC1=NC=C(C=C1)C=C
Isomeric SMILES
CC1=NC=C(C=C1)C=C
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C8H9N
Heavy Atom Count
9
Molecular Weight
119.167
Exact Molecular Weight
119.0735
Valence Electrons
46
Radical Electrons
0
tPSA
12.89
MolLogP
2.033
H Bond Acceptors
1
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
1
Aliphatic Rings
0
Aromatic Rings
1

MOL File


     RDKit          3D

 18 18  0  0  0  0  0  0  0  0999 V2000
    3.2614   -0.7804   -0.0261 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4554    0.2016   -0.3107 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0209    0.1413   -0.1036 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1922    1.2046   -0.4173 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1629    1.1577   -0.2257 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6869   -0.0043    0.2996 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8942   -1.0440    0.6086 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.4499   -0.9937    0.4170 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1530   -0.1622    0.5492 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3388   -0.6447   -0.2173 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9676   -1.7083    0.3775 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8445    1.1412   -0.7311 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6241    2.1155   -0.8319 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8267    1.9756   -0.4636 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0009   -1.8884    0.6996 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2822   -0.0639    1.6535 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4006   -1.2142    0.2937 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.7491    0.5665   -0.0144 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  6  9  1  0
  8  3  1  0
  1 10  1  0
  1 11  1  0
  2 12  1  0
  4 13  1  0
  5 14  1  0
  8 15  1  0
  9 16  1  0
  9 17  1  0
  9 18  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers