Monomers

2,3-Dichloro-1-propene

Identifiers

IUPAC name
2,3-dichloroprop-1-ene
InchI
InChI=1S/C3H4Cl2/c1-3(5)2-4/h1-2H2
InchI Key
FALCMQXTWHPRIH-UHFFFAOYSA-N
SMILES
ClCC(=C)Cl
Canonical SMILES
C=C(CCl)Cl
Isomeric SMILES
C=C(CCl)Cl
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C3H4Cl2
Heavy Atom Count
5
Molecular Weight
110.971
Exact Molecular Weight
109.969
Valence Electrons
30
Radical Electrons
0
tPSA
0.0
MolLogP
1.9777
H Bond Acceptors
0
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

  9  8  0  0  0  0  0  0  0  0999 V2000
    1.2743   -0.0055    2.0794 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    0.9798   -0.2910    0.3425 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2191    0.4611   -0.1077 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2416   -0.1963   -0.6080 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3426    2.1991   -0.0057 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    1.8984    0.1065   -0.1819 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.9209   -1.3481    0.0848 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1584   -1.2749   -0.6687 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1118    0.3491   -0.9348 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  3
  3  5  1  0
  2  6  1  0
  2  7  1  0
  4  8  1  0
  4  9  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers