Monomers

2-Chlorostyrene

Identifiers

IUPAC name
1-chloro-2-ethenylbenzene
InchI
InChI=1S/C8H7Cl/c1-2-7-5-3-4-6-8(7)9/h2-6H,1H2
InchI Key
ISRGONDNXBCDBM-UHFFFAOYSA-N
SMILES
C=Cc1ccccc1Cl
Canonical SMILES
C=CC1=CC=CC=C1Cl
Isomeric SMILES
C=CC1=CC=CC=C1Cl
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C8H7Cl
Heavy Atom Count
9
Molecular Weight
138.597
Exact Molecular Weight
138.0236
Valence Electrons
46
Radical Electrons
0
tPSA
0.0
MolLogP
2.983
H Bond Acceptors
0
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
1
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
1

MOL File


     RDKit          3D

 16 16  0  0  0  0  0  0  0  0999 V2000
    2.6078    0.7297   -0.6984 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8808   -0.1428   -0.0687 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4359   -0.1334    0.0450 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2402   -1.3550    0.2575 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6054   -1.4079    0.3943 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3871   -0.2747    0.3318 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7265    0.9085    0.1261 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3275    0.9909   -0.0170 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3880    2.5634   -0.2365 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    3.7046    0.5773   -0.6875 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2910    1.5815   -1.2506 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4115   -0.9926    0.4432 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3939   -2.2395    0.3039 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0635   -2.3709    0.5546 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4631   -0.2779    0.4346 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3004    1.8434    0.0678 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  8  9  1  0
  8  3  1  0
  1 10  1  0
  1 11  1  0
  2 12  1  0
  4 13  1  0
  5 14  1  0
  6 15  1  0
  7 16  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers