Monomers
Cyanomethyl 2-methylprop-2-enoate
Identifiers
IUPAC name
cyanomethyl 2-methylprop-2-enoate
InchI
InChI=1S/C6H7NO2/c1-5(2)6(8)9-4-3-7/h1,4H2,2H3
InchI Key
KXTNMKREYTVOMX-UHFFFAOYSA-N
SMILES
CC(=C)C(=O)OCC#N
Canonical SMILES
CC(=C)C(=O)OCC#N
Isomeric SMILES
CC(=C)C(=O)OCC#N
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C6H7NO2
Heavy Atom Count
9
Molecular Weight
125.127
Exact Molecular Weight
125.0477
Valence Electrons
48
Radical Electrons
0
tPSA
50.09
MolLogP
0.6293
H Bond Acceptors
3
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
16 15 0 0 0 0 0 0 0 0999 V2000
-0.8846 -2.0827 0.8278 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9687 -0.6579 0.4104 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0730 0.0607 0.5916 C 0 0 0 0 0 0 0 0 0 0 0 0
0.1994 -0.0842 -0.2010 C 0 0 0 0 0 0 0 0 0 0 0 0
1.2175 -0.7738 -0.3596 O 0 0 0 0 0 0 0 0 0 0 0 0
0.1549 1.2346 -0.5996 O 0 0 0 0 0 0 0 0 0 0 0 0
1.3403 1.7689 -1.2050 C 0 0 0 0 0 0 0 0 0 0 0 0
2.4569 1.6957 -0.2997 C 0 0 0 0 0 0 0 0 0 0 0 0
3.3797 1.6315 0.4230 N 0 0 0 0 0 0 0 0 0 0 0 0
-1.8114 -2.4496 1.2882 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.6675 -2.6850 -0.1005 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.0384 -2.1857 1.5391 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.9039 -0.4273 1.0517 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0823 1.0873 0.2719 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5615 1.0862 -2.0675 H 0 0 0 0 0 0 0 0 0 0 0 0
1.1198 2.7813 -1.5707 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 3
2 4 1 0
4 5 2 0
4 6 1 0
6 7 1 0
7 8 1 0
8 9 3 0
1 10 1 0
1 11 1 0
1 12 1 0
3 13 1 0
3 14 1 0
7 15 1 0
7 16 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers