Monomers

2-Ethylacrylic acid

Identifiers

IUPAC name
2-methylidenebutanoic acid
InchI
InChI=1S/C5H8O2/c1-3-4(2)5(6)7/h2-3H2,1H3,(H,6,7)
InchI Key
WROUWQQRXUBECT-UHFFFAOYSA-N
SMILES
CCC(=C)C(=O)O
Canonical SMILES
CCC(=C)C(=O)O
Isomeric SMILES
CCC(=C)C(=O)O
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C5H8O2
Heavy Atom Count
7
Molecular Weight
100.117
Exact Molecular Weight
100.0524
Valence Electrons
40
Radical Electrons
0
tPSA
37.3
MolLogP
1.0372
H Bond Acceptors
1
H Bond Donors
1
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 15 14  0  0  0  0  0  0  0  0999 V2000
   -1.3072   -0.0529    1.1649 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9559    0.4293   -0.2260 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3164   -0.1217   -0.7153 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3825   -0.8580   -1.8106 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5203    0.1676    0.0472 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6500   -0.2784   -0.3218 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.4881    0.9315    1.1933 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3967   -0.3400    1.1269 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2546    0.7782    1.9069 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7589   -0.9470    1.4713 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7577    0.1821   -0.9709 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9394    1.5482   -0.1903 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2992   -1.2758   -2.1946 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5178   -1.0660   -2.3682 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2317    0.9029    1.8872 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  3
  3  5  1  0
  5  6  2  0
  5  7  1  0
  1  8  1  0
  1  9  1  0
  1 10  1  0
  2 11  1  0
  2 12  1  0
  4 13  1  0
  4 14  1  0
  7 15  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers