Monomers
3-Methyl-3-buten-2-one
Identifiers
IUPAC name
3-methylbut-3-en-2-one
InchI
InChI=1S/C5H8O/c1-4(2)5(3)6/h1H2,2-3H3
InchI Key
ZGHFDIIVVIFNPS-UHFFFAOYSA-N
SMILES
CC(=O)C(=C)C
Canonical SMILES
CC(=C)C(=O)C
Isomeric SMILES
CC(=C)C(=O)C
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C5H8O
Heavy Atom Count
6
Molecular Weight
84.118
Exact Molecular Weight
84.0575
Valence Electrons
34
Radical Electrons
0
tPSA
17.07
MolLogP
1.1515
H Bond Acceptors
1
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
14 13 0 0 0 0 0 0 0 0999 V2000
1.9037 0.0972 0.1696 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7207 -0.7808 0.4015 C 0 0 0 0 0 0 0 0 0 0 0 0
0.9557 -1.9697 0.7415 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.6228 -0.2630 0.2359 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.6567 -1.0449 0.4426 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8451 1.1450 -0.1659 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7173 0.7813 -0.6874 H 0 0 0 0 0 0 0 0 0 0 0 0
2.0768 0.7403 1.0753 H 0 0 0 0 0 0 0 0 0 0 0 0
2.8214 -0.5045 0.0077 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6426 -0.6377 0.3134 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5635 -2.0849 0.7384 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.8882 1.2699 -0.5655 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8024 1.7548 0.7639 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.1743 1.4969 -0.9530 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 2 3
4 6 1 0
1 7 1 0
1 8 1 0
1 9 1 0
5 10 1 0
5 11 1 0
6 12 1 0
6 13 1 0
6 14 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers