Monomers

2-Cyanoethyl acrylate

Identifiers

IUPAC name
2-cyanoethyl prop-2-enoate
InchI
InChI=1S/C6H7NO2/c1-2-6(8)9-5-3-4-7/h2H,1,3,5H2
InchI Key
AEPWOCLBLLCOGZ-UHFFFAOYSA-N
SMILES
C=CC(=O)OCCC#N
Canonical SMILES
C=CC(=O)OCCC#N
Isomeric SMILES
C=CC(=O)OCCC#N
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C6H7NO2
Heavy Atom Count
9
Molecular Weight
125.127
Exact Molecular Weight
125.0477
Valence Electrons
48
Radical Electrons
0
tPSA
50.09
MolLogP
0.6293
H Bond Acceptors
3
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 16 15  0  0  0  0  0  0  0  0999 V2000
    1.5909    2.4598   -1.4332 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3244    1.4600   -0.6959 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3952    0.3454   -0.7169 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4358   -0.0467   -1.4399 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.5874   -0.4651    0.4867 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0269   -1.6018    0.8486 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5161   -1.6834    0.5240 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9828   -0.1988    1.0059 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2899    0.8419    1.3364 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0919    2.7031   -2.3597 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4561    3.1164   -1.1115 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1083    1.3961    0.1913 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.4227   -2.5506    0.4467 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1103   -1.7068    1.9808 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0140   -2.2026    1.3636 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8214   -1.8671   -0.4269 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  3  0
  1 10  1  0
  1 11  1  0
  2 12  1  0
  6 13  1  0
  6 14  1  0
  7 15  1  0
  7 16  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers