Monomers
Allyl propionate
Identifiers
IUPAC name
prop-2-enyl propanoate
InchI
InChI=1S/C6H10O2/c1-3-5-8-6(7)4-2/h3H,1,4-5H2,2H3
InchI Key
XRFWKHVQMACVTA-UHFFFAOYSA-N
SMILES
CCC(=O)OCC=C
Canonical SMILES
CCC(=O)OCC=C
Isomeric SMILES
CCC(=O)OCC=C
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C6H10O2
Heavy Atom Count
8
Molecular Weight
114.144
Exact Molecular Weight
114.0681
Valence Electrons
46
Radical Electrons
0
tPSA
26.3
MolLogP
1.1256
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
18 17 0 0 0 0 0 0 0 0999 V2000
-3.3037 0.1336 0.2705 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0970 0.1768 -0.6067 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8570 -0.1261 0.1495 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9453 -0.3739 1.3803 O 0 0 0 0 0 0 0 0 0 0 0 0
0.3761 -0.1464 -0.4382 O 0 0 0 0 0 0 0 0 0 0 0 0
1.5867 -0.4299 0.2419 C 0 0 0 0 0 0 0 0 0 0 0 0
2.7006 -0.3556 -0.7299 C 0 0 0 0 0 0 0 0 0 0 0 0
3.6733 0.5042 -0.5472 C 0 0 0 0 0 0 0 0 0 0 0 0
-4.2029 -0.1816 -0.3329 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.5777 1.1298 0.6856 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.2247 -0.5816 1.1175 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.0583 1.1973 -1.0722 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.2169 -0.5341 -1.4748 H 0 0 0 0 0 0 0 0 0 0 0 0
1.7410 0.2974 1.0661 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5342 -1.4414 0.7383 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7193 -1.0049 -1.5902 H 0 0 0 0 0 0 0 0 0 0 0 0
3.6550 1.1526 0.3114 H 0 0 0 0 0 0 0 0 0 0 0 0
4.4974 0.5836 -1.2346 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 1 0
7 8 2 3
1 9 1 0
1 10 1 0
1 11 1 0
2 12 1 0
2 13 1 0
6 14 1 0
6 15 1 0
7 16 1 0
8 17 1 0
8 18 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers