Monomers

Citraconic acid

Identifiers

IUPAC name
(Z)-2-methylbut-2-enedioic acid
InchI
InChI=1S/C5H6O4/c1-3(5(8)9)2-4(6)7/h2H,1H3,(H,6,7)(H,8,9)/b3-2-
InchI Key
HNEGQIOMVPPMNR-IHWYPQMZSA-N
SMILES
OC(=O)/C=C(\C(=O)O)/C
Canonical SMILES
CC(=CC(=O)O)C(=O)O
Isomeric SMILES
C/C(=C/C(=O)O)/C(=O)O
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C5H6O4
Heavy Atom Count
9
Molecular Weight
130.099
Exact Molecular Weight
130.0266
Valence Electrons
50
Radical Electrons
0
tPSA
74.6
MolLogP
0.1019
H Bond Acceptors
2
H Bond Donors
2
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 15 14  0  0  0  0  0  0  0  0999 V2000
    2.0520   -1.1049   -0.8067 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.9681   -0.5247    0.4385 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0026   -0.5344    1.1866 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7488    0.0994    0.9373 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3605    0.1546    0.2361 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5648    0.7849    0.7600 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5891    1.3065    1.9174 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7444    0.8542    0.0383 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4372   -0.4281   -1.1337 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9356   -0.9909   -1.3256 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.7345    0.5416    1.9232 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3575    1.6514    0.2153 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2329   -1.5249   -1.0123 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4524   -0.3427   -1.5630 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2972    0.0580   -1.8113 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  3
  5  6  1  0
  6  7  2  0
  6  8  1  0
  5  9  1  0
  1 10  1  0
  4 11  1  0
  8 12  1  0
  9 13  1  0
  9 14  1  0
  9 15  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers