Monomers

Maleic acid

Identifiers

IUPAC name
(Z)-but-2-enedioic acid
InchI
InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1-
InchI Key
VZCYOOQTPOCHFL-UPHRSURJSA-N
SMILES
OC(=O)/C=C\C(=O)O
Canonical SMILES
C(=CC(=O)O)C(=O)O
Isomeric SMILES
C(=C\C(=O)O)\C(=O)O
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C4H4O4
Heavy Atom Count
8
Molecular Weight
116.072
Exact Molecular Weight
116.011
Valence Electrons
44
Radical Electrons
0
tPSA
74.6
MolLogP
-0.2882
H Bond Acceptors
2
H Bond Donors
2
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 12 11  0  0  0  0  0  0  0  0999 V2000
   -2.3522    0.8925   -0.3898 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9371   -0.3853   -0.0389 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.7622   -1.2866    0.2480 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5112   -0.6876   -0.0025 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4028    0.2223   -0.2949 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8168   -0.0537   -0.2657 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2272   -1.1958    0.0467 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.7630    0.9095   -0.5744 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2748    1.2029   -0.1286 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1543   -1.6731    0.2669 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.0341    1.2226   -0.5681 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7477    0.8322   -0.3245 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  3
  5  6  1  0
  6  7  2  0
  6  8  1  0
  1  9  1  0
  4 10  1  0
  5 11  1  0
  8 12  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers