Monomers

Fumaric acid

Identifiers

IUPAC name
(E)-but-2-enedioic acid
InchI
InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+
InchI Key
VZCYOOQTPOCHFL-OWOJBTEDSA-N
SMILES
OC(=O)/C=C/C(=O)O
Canonical SMILES
C(=CC(=O)O)C(=O)O
Isomeric SMILES
C(=C/C(=O)O)\C(=O)O
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C4H4O4
Heavy Atom Count
8
Molecular Weight
116.072
Exact Molecular Weight
116.011
Valence Electrons
44
Radical Electrons
0
tPSA
74.6
MolLogP
-0.2882
H Bond Acceptors
2
H Bond Donors
2
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 12 11  0  0  0  0  0  0  0  0999 V2000
    2.4496    0.2948    0.7833 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.7605   -0.6236   -0.0211 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4124   -1.5315   -0.5793 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3148   -0.5126   -0.1958 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3329    0.4623    0.4128 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7782    0.5318    0.2074 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4312    1.4464    0.7703 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4544   -0.3785   -0.5887 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4307    0.4953    0.6497 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1829   -1.2352   -0.8208 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1987    1.1673    1.0307 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3870   -0.1165   -0.8892 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  0
  2  4  1  0
  4  5  2  3
  5  6  1  0
  6  7  2  0
  6  8  1  0
  1  9  1  0
  4 10  1  0
  5 11  1  0
  8 12  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers