Monomers

Methyl crotonate

Identifiers

IUPAC name
methyl (E)-but-2-enoate
InchI
InChI=1S/C5H8O2/c1-3-4-5(6)7-2/h3-4H,1-2H3/b4-3+
InchI Key
MCVVUJPXSBQTRZ-ONEGZZNKSA-N
SMILES
C/C=C/C(=O)OC
Canonical SMILES
CC=CC(=O)OC
Isomeric SMILES
C/C=C/C(=O)OC
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C5H8O2
Heavy Atom Count
7
Molecular Weight
100.117
Exact Molecular Weight
100.0524
Valence Electrons
40
Radical Electrons
0
tPSA
26.3
MolLogP
0.7355
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 15 14  0  0  0  0  0  0  0  0999 V2000
   -2.8502    0.0683    0.3771 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3701    0.0597    0.3597 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6718   -0.1064   -0.7617 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7761   -0.1149   -0.7797 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3938   -0.2751   -1.8625 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5114    0.0510    0.3813 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.9198    0.0438    0.3712 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1693   -0.3226    1.3845 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2242    1.1135    0.2193 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2803   -0.5959   -0.4056 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8208    0.1912    1.2782 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2284   -0.2357   -1.6657 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3146   -0.5039   -0.5072 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3524    1.0666    0.3368 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3469   -0.4397    1.2742 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  3
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  1  0
  1  8  1  0
  1  9  1  0
  1 10  1  0
  2 11  1  0
  3 12  1  0
  7 13  1  0
  7 14  1  0
  7 15  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers