Monomers

Isobutylene

Identifiers

IUPAC name
2-methylprop-1-ene
InchI
InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3
InchI Key
VQTUBCCKSQIDNK-UHFFFAOYSA-N
SMILES
CC(=C)C
Canonical SMILES
CC(=C)C
Isomeric SMILES
CC(=C)C
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C4H8
Heavy Atom Count
4
Molecular Weight
56.108
Exact Molecular Weight
56.0626
Valence Electrons
24
Radical Electrons
0
tPSA
0.0
MolLogP
1.5824
H Bond Acceptors
0
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 12 11  0  0  0  0  0  0  0  0999 V2000
    1.3693   -0.4220   -0.0748 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0144    0.1029    0.0218 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1844    1.4128    0.0464 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2360   -0.7407    0.0936 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9959   -0.1254    0.7848 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3795   -1.5125   -0.2544 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.8607    0.0368   -0.9750 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1578    1.8871    0.1154 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6611    2.0877   -0.0024 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6742   -0.7288   -0.9448 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0307   -1.7656    0.4444 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9691   -0.2325    0.7448 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  3
  2  4  1  0
  1  5  1  0
  1  6  1  0
  1  7  1  0
  3  8  1  0
  3  9  1  0
  4 10  1  0
  4 11  1  0
  4 12  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers