Monomers
Methyl vinyl ketone
Identifiers
IUPAC name
but-3-en-2-one
InchI
InChI=1S/C4H6O/c1-3-4(2)5/h3H,1H2,2H3
InchI Key
FUSUHKVFWTUUBE-UHFFFAOYSA-N
SMILES
CC(=O)C=C
Canonical SMILES
CC(=O)C=C
Isomeric SMILES
CC(=O)C=C
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C4H6O
Heavy Atom Count
5
Molecular Weight
70.091
Exact Molecular Weight
70.0419
Valence Electrons
28
Radical Electrons
0
tPSA
17.07
MolLogP
0.7614
H Bond Acceptors
1
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
11 10 0 0 0 0 0 0 0 0999 V2000
-1.4580 -0.0520 0.9631 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0948 0.3107 0.4847 C 0 0 0 0 0 0 0 0 0 0 0 0
0.6347 1.1353 1.0936 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4586 -0.2829 -0.7256 C 0 0 0 0 0 0 0 0 0 0 0 0
1.6590 0.0106 -1.1824 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7069 -1.1097 0.7039 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4633 0.0360 2.0704 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.2344 0.6507 0.5887 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.1271 -0.9980 -1.2871 H 0 0 0 0 0 0 0 0 0 0 0 0
2.2561 0.7201 -0.6366 H 0 0 0 0 0 0 0 0 0 0 0 0
2.0760 -0.4210 -2.0728 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 2 3
1 6 1 0
1 7 1 0
1 8 1 0
4 9 1 0
5 10 1 0
5 11 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers