Monomers
Vinyl chloroacetate
Identifiers
IUPAC name
ethenyl 2-chloroacetate
InchI
InChI=1S/C4H5ClO2/c1-2-7-4(6)3-5/h2H,1,3H2
InchI Key
XJELOQYISYPGDX-UHFFFAOYSA-N
SMILES
ClCC(=O)OC=C
Canonical SMILES
C=COC(=O)CCl
Isomeric SMILES
C=COC(=O)CCl
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C4H5ClO2
Heavy Atom Count
7
Molecular Weight
120.535
Exact Molecular Weight
119.9978
Valence Electrons
40
Radical Electrons
0
tPSA
26.3
MolLogP
0.9119
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
12 11 0 0 0 0 0 0 0 0999 V2000
2.9616 1.4026 0.1501 Cl 0 0 0 0 0 0 0 0 0 0 0 0
2.2049 -0.1199 0.6334 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8967 -0.3339 -0.0228 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8047 -0.9267 -1.1207 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2651 0.1221 0.5704 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.5019 -0.0530 -0.0005 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5587 0.4142 0.6346 C 0 0 0 0 0 0 0 0 0 0 0 0
2.8419 -1.0020 0.3519 H 0 0 0 0 0 0 0 0 0 0 0 0
2.1465 -0.1247 1.7395 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.5597 -0.5681 -0.9500 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.5154 0.2677 0.1730 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4557 0.9217 1.5796 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 1 0
6 7 2 3
2 8 1 0
2 9 1 0
6 10 1 0
7 11 1 0
7 12 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers