Monomers

Perfluoromethacryloyl fluoride

Identifiers

IUPAC name
3,3-difluoro-2-(trifluoromethyl)prop-2-enoyl fluoride
InchI
InChI=1S/C4F6O/c5-2(6)1(3(7)11)4(8,9)10
InchI Key
PKMLXJCOQLUBAX-UHFFFAOYSA-N
SMILES
FC(=C(C(F)(F)F)C(=O)F)F
Canonical SMILES
C(=C(F)F)(C(=O)F)C(F)(F)F
Isomeric SMILES
C(=C(F)F)(C(=O)F)C(F)(F)F
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C4F6O
Heavy Atom Count
11
Molecular Weight
178.031
Exact Molecular Weight
177.9853
Valence Electrons
64
Radical Electrons
0
tPSA
17.07
MolLogP
2.1954
H Bond Acceptors
1
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 11 10  0  0  0  0  0  0  0  0999 V2000
    1.7068    1.3942    1.0228 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.4197    1.1599    0.6643 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1482    0.0243    0.0472 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2698   -0.2296   -0.3457 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0531    0.8307    0.0356 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6870   -1.3753    0.2559 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3149   -0.3147   -1.7272 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.2091   -0.9143   -0.2215 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9532   -1.9818   -0.8017 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4616   -0.6377    0.1516 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.5737    2.0443    0.9187 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  3
  3  4  1  0
  4  5  1  0
  4  6  1  0
  4  7  1  0
  3  8  1  0
  8  9  2  0
  8 10  1  0
  2 11  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers