Monomers

Tetrafluoroethylene

Identifiers

IUPAC name
1,1,2,2-tetrafluoroethene
InchI
InChI=1S/C2F4/c3-1(4)2(5)6
InchI Key
BFKJFAAPBSQJPD-UHFFFAOYSA-N
SMILES
FC(=C(F)F)F
Canonical SMILES
C(=C(F)F)(F)F
Isomeric SMILES
C(=C(F)F)(F)F
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C2F4
Heavy Atom Count
6
Molecular Weight
100.014
Exact Molecular Weight
99.9936
Valence Electrons
36
Radical Electrons
0
tPSA
0.0
MolLogP
1.991
H Bond Acceptors
0
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

  6  5  0  0  0  0  0  0  0  0999 V2000
   -1.5220   -0.9103   -0.3447 F   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6568    0.0905   -0.0474 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6529   -0.1022    0.0446 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2059   -1.3265   -0.1562 F   0  0  0  0  0  0  0  0  0  0  0  0
    1.4949    0.9205    0.3441 F   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1750    1.3280    0.1596 F   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  3
  3  4  1  0
  3  5  1  0
  2  6  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers