Monomers
Methyl 2-fluoroacrylate
Identifiers
IUPAC name
methyl 2-fluoroprop-2-enoate
InchI
InChI=1S/C4H5FO2/c1-3(5)4(6)7-2/h1H2,2H3
InchI Key
ZTZJVAOTIOAZGZ-UHFFFAOYSA-N
SMILES
COC(=O)C(=C)F
Canonical SMILES
COC(=O)C(=C)F
Isomeric SMILES
COC(=O)C(=C)F
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C4H5FO2
Heavy Atom Count
7
Molecular Weight
104.08
Exact Molecular Weight
104.0274
Valence Electrons
40
Radical Electrons
0
tPSA
26.3
MolLogP
0.6426
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
12 11 0 0 0 0 0 0 0 0999 V2000
2.0335 -0.0820 -0.6096 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7437 -0.2252 -0.0780 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.3250 0.5762 -0.3452 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1702 1.5408 -1.1375 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.6099 0.3080 0.2809 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.7202 -0.7130 1.1020 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6807 1.1196 0.0066 F 0 0 0 0 0 0 0 0 0 0 0 0
2.0866 0.5235 -1.5228 H 0 0 0 0 0 0 0 0 0 0 0 0
2.4579 -1.0835 -0.8139 H 0 0 0 0 0 0 0 0 0 0 0 0
2.6697 0.3391 0.2241 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6322 -0.9851 1.6092 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8532 -1.3184 1.2843 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 2 3
5 7 1 0
1 8 1 0
1 9 1 0
1 10 1 0
6 11 1 0
6 12 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers