Monomers

N-(2-Hydroxypropyl)methacrylamide

Identifiers

IUPAC name
N-(2-hydroxypropyl)-2-methylprop-2-enamide
InchI
InChI=1S/C7H13NO2/c1-5(2)7(10)8-4-6(3)9/h6,9H,1,4H2,2-3H3,(H,8,10)
InchI Key
OKPYIWASQZGASP-UHFFFAOYSA-N
SMILES
CC(CNC(=O)C(=C)C)O
Canonical SMILES
CC(CNC(=O)C(=C)C)O
Isomeric SMILES
CC(CNC(=O)C(=C)C)O
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C7H13NO2
Heavy Atom Count
10
Molecular Weight
143.186
Exact Molecular Weight
143.0946
Valence Electrons
58
Radical Electrons
0
tPSA
49.33
MolLogP
0.0595
H Bond Acceptors
2
H Bond Donors
2
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 23 22  0  0  0  0  0  0  0  0999 V2000
   -3.4653    0.0790    0.6511 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0068   -0.3137    0.3827 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2991    0.9463   -0.0263 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0555    0.7311   -0.4565 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.0308    0.1664    0.3820 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6280   -0.1422    1.5542 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4182   -0.0784    0.0093 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8992    0.2167   -1.1847 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3413   -0.6836    1.0013 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.0506   -1.2011   -0.6961 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9500    0.3612   -0.3094 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0045   -0.6841    1.2073 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.3996    1.0424    1.2336 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6289   -0.7623    1.2998 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3648    1.6669    0.8410 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8974    1.4116   -0.8358 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3355    1.0000   -1.4239 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.9259    0.0289   -1.4418 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2702    0.6530   -1.9276 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2085    0.0021    1.2195 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7570   -1.6362    0.5710 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8470   -0.8441    1.9747 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6502   -1.9597   -0.5464 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  2  3
  7  9  1  0
  2 10  1  0
  1 11  1  0
  1 12  1  0
  1 13  1  0
  2 14  1  0
  3 15  1  0
  3 16  1  0
  4 17  1  0
  8 18  1  0
  8 19  1  0
  9 20  1  0
  9 21  1  0
  9 22  1  0
 10 23  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers