Monomers

3-Vinylphenol

Identifiers

IUPAC name
3-ethenylphenol
InchI
InChI=1S/C8H8O/c1-2-7-4-3-5-8(9)6-7/h2-6,9H,1H2
InchI Key
YNGIFMKMDRDNBQ-UHFFFAOYSA-N
SMILES
C=Cc1cccc(c1)O
Canonical SMILES
C=CC1=CC(=CC=C1)O
Isomeric SMILES
C=CC1=CC(=CC=C1)O
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C8H8O
Heavy Atom Count
9
Molecular Weight
120.151
Exact Molecular Weight
120.0575
Valence Electrons
46
Radical Electrons
0
tPSA
20.23
MolLogP
2.0352
H Bond Acceptors
1
H Bond Donors
1
Aliphatic Carbocycles
0
Aromatic Carbocycles
1
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
1

MOL File


     RDKit          3D

 17 17  0  0  0  0  0  0  0  0999 V2000
    2.6666   -1.1320   -0.1482 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1060    0.0368   -0.2938 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6591    0.2220   -0.1658 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1029    1.4910   -0.3297 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2475    1.7358   -0.2230 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1165    0.7045    0.0573 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5828   -0.5546    0.2220 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2131   -0.8057    0.1142 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4653   -1.5908    0.5046 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1705   -2.0638    0.0728 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7542   -1.2281   -0.2522 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.7150    0.8900   -0.5135 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8096    2.2883   -0.5503 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6582    2.7385   -0.3558 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1926    0.8822    0.1454 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1826   -1.7997    0.2471 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6905   -1.8145    1.4688 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  8  3  1  0
  1 10  1  0
  1 11  1  0
  2 12  1  0
  4 13  1  0
  5 14  1  0
  6 15  1  0
  8 16  1  0
  9 17  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers