Monomers
1-(2-Hydroxyethyl)-1H-pyrrole-2,5-dione
Identifiers
IUPAC name
1-(2-hydroxyethyl)pyrrole-2,5-dione
InchI
InChI=1S/C6H7NO3/c8-4-3-7-5(9)1-2-6(7)10/h1-2,8H,3-4H2
InchI Key
AXTADRUCVAUCRS-UHFFFAOYSA-N
SMILES
OCCN1C(=O)C=CC1=O
Canonical SMILES
C1=CC(=O)N(C1=O)CCO
Isomeric SMILES
C1=CC(=O)N(C1=O)CCO
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C6H7NO3
Heavy Atom Count
10
Molecular Weight
141.126
Exact Molecular Weight
141.0426
Valence Electrons
54
Radical Electrons
0
tPSA
57.61
MolLogP
-1.0963
H Bond Acceptors
3
H Bond Donors
1
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
1
Aromatic Heterocycles
0
Aliphatic Rings
1
Aromatic Rings
0
MOL File
RDKit 3D
17 17 0 0 0 0 0 0 0 0999 V2000
-3.2933 -0.0637 -0.2423 O 0 0 0 0 0 0 0 0 0 0 0 0
-1.9582 -0.2545 -0.6389 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.0970 0.1062 0.5152 C 0 0 0 0 0 0 0 0 0 0 0 0
0.3128 -0.0238 0.3049 N 0 0 0 0 0 0 0 0 0 0 0 0
1.1113 1.0395 -0.1995 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7166 2.2112 -0.5253 O 0 0 0 0 0 0 0 0 0 0 0 0
2.4800 0.5523 -0.2813 C 0 0 0 0 0 0 0 0 0 0 0 0
2.5347 -0.7002 0.1332 C 0 0 0 0 0 0 0 0 0 0 0 0
1.1923 -1.1007 0.5111 C 0 0 0 0 0 0 0 0 0 0 0 0
0.8579 -2.2229 0.9517 O 0 0 0 0 0 0 0 0 0 0 0 0
-3.3070 0.8116 0.2317 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.8779 -1.2785 -0.9942 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.8059 0.4250 -1.5025 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.3567 -0.5111 1.4014 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.3099 1.1531 0.8065 H 0 0 0 0 0 0 0 0 0 0 0 0
3.3429 1.1401 -0.6362 H 0 0 0 0 0 0 0 0 0 0 0 0
3.4574 -1.2836 0.1644 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 1 0
5 6 2 0
5 7 1 0
7 8 2 0
8 9 1 0
9 10 2 0
9 4 1 0
1 11 1 0
2 12 1 0
2 13 1 0
3 14 1 0
3 15 1 0
7 16 1 0
8 17 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers