Monomers
2-Bromo-2-butenoic acid ethyl ester
Identifiers
IUPAC name
ethyl (Z)-2-bromobut-2-enoate
InchI
InChI=1S/C6H9BrO2/c1-3-5(7)6(8)9-4-2/h3H,4H2,1-2H3/b5-3-
InchI Key
YHGVZVYRHWZVKI-HYXAFXHYSA-N
SMILES
CCOC(=O)/C(=C/C)/Br
Canonical SMILES
CCOC(=O)C(=CC)Br
Isomeric SMILES
CCOC(=O)/C(=C/C)/Br
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C6H9BrO2
Heavy Atom Count
9
Molecular Weight
193.04
Exact Molecular Weight
191.9786
Valence Electrons
52
Radical Electrons
0
tPSA
26.3
MolLogP
1.8482
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
18 17 0 0 0 0 0 0 0 0999 V2000
-3.0004 -0.6505 0.3787 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2996 0.6945 0.5277 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8976 0.5537 0.4971 O 0 0 0 0 0 0 0 0 0 0 0 0
-0.2026 0.0191 -0.5844 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8957 -0.3456 -1.5654 O 0 0 0 0 0 0 0 0 0 0 0 0
1.2581 -0.1143 -0.5856 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0201 0.2451 0.3976 C 0 0 0 0 0 0 0 0 0 0 0 0
3.4817 0.0808 0.3255 C 0 0 0 0 0 0 0 0 0 0 0 0
2.0723 -0.8641 -2.1355 Br 0 0 0 0 0 0 0 0 0 0 0 0
-2.9087 -1.0711 -0.6243 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.0638 -0.5097 0.6164 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.5323 -1.2973 1.1739 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.5597 1.0547 1.5459 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6878 1.4221 -0.2043 H 0 0 0 0 0 0 0 0 0 0 0 0
1.5854 0.6719 1.2860 H 0 0 0 0 0 0 0 0 0 0 0 0
3.9015 -0.3708 1.2705 H 0 0 0 0 0 0 0 0 0 0 0 0
3.9229 1.0835 0.1399 H 0 0 0 0 0 0 0 0 0 0 0 0
3.8062 -0.6021 -0.4845 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 1 0
4 5 2 0
4 6 1 0
6 7 2 3
7 8 1 0
6 9 1 0
1 10 1 0
1 11 1 0
1 12 1 0
2 13 1 0
2 14 1 0
7 15 1 0
8 16 1 0
8 17 1 0
8 18 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers