Monomers

CID 95516

Identifiers

IUPAC name
penta-2,4-dienoic acid
InchI
InChI=1S/C5H6O2/c1-2-3-4-5(6)7/h2-4H,1H2,(H,6,7)
InchI Key
SDVVLIIVFBKBMG-UHFFFAOYSA-N
SMILES
C=CC=CC(=O)O
Canonical SMILES
C=CC=CC(=O)O
Isomeric SMILES
C=CC=CC(=O)O
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C5H6O2
Heavy Atom Count
7
Molecular Weight
98.101
Exact Molecular Weight
98.0368
Valence Electrons
38
Radical Electrons
0
tPSA
37.3
MolLogP
0.8132
H Bond Acceptors
1
H Bond Donors
1
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 13 12  0  0  0  0  0  0  0  0999 V2000
   -2.7608   -0.0255   -0.0682 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5807   -0.5962   -0.0601 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3579    0.1949    0.1203 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8214   -0.3944    0.1260 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0306    0.3926    0.3050 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9200    1.6329    0.4519 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2982   -0.1405    0.3237 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8181    1.0419    0.0608 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.6353   -0.6278   -0.2017 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5093   -1.6682   -0.1886 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4239    1.2650    0.2490 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8676   -1.4877   -0.0069 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1481    0.4129    0.3901 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  2  3
  4  5  1  0
  5  6  2  0
  5  7  1  0
  1  8  1  0
  1  9  1  0
  2 10  1  0
  3 11  1  0
  4 12  1  0
  7 13  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers