Monomers

Methacrylic acid methylthiomethyl ester

Identifiers

IUPAC name
methylsulfanylmethyl 2-methylprop-2-enoate
InchI
InChI=1S/C6H10O2S/c1-5(2)6(7)8-4-9-3/h1,4H2,2-3H3
InchI Key
AHJQXEBSKMYLKC-UHFFFAOYSA-N
SMILES
CSCOC(=O)C(=C)C
Canonical SMILES
CC(=C)C(=O)OCSC
Isomeric SMILES
CC(=C)C(=O)OCSC
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C6H10O2S
Heavy Atom Count
9
Molecular Weight
146.211
Exact Molecular Weight
146.0402
Valence Electrons
52
Radical Electrons
0
tPSA
26.3
MolLogP
1.4262
H Bond Acceptors
3
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 19 18  0  0  0  0  0  0  0  0999 V2000
    2.9745    0.5676    0.9309 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5907   -0.3956   -0.5329 S   0  0  0  0  0  0  0  0  0  0  0  0
    1.2868   -1.5994   -0.1507 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0938   -0.8963    0.1316 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4697   -0.0730   -0.8181 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0757    0.0565   -1.9394 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6958    0.6449   -0.5208 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2384    1.4348   -1.4331 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3070    0.4602    0.8193 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8785    0.1168    1.4277 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1372    0.5277    1.6453 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2801    1.6138    0.6880 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1655   -2.3403   -0.9762 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5447   -2.1605    0.7934 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.7550    1.5266   -2.3786 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1547    1.9592   -1.1854 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4685   -0.6266    1.0434 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.2939    0.9702    0.8317 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6446    0.8270    1.6241 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  7  8  2  3
  7  9  1  0
  1 10  1  0
  1 11  1  0
  1 12  1  0
  3 13  1  0
  3 14  1  0
  8 15  1  0
  8 16  1  0
  9 17  1  0
  9 18  1  0
  9 19  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers