Monomers

Vinyl ethyl oxalate

Identifiers

IUPAC name
2-O-ethenyl 1-O-ethyl oxalate
InchI
InChI=1S/C6H8O4/c1-3-9-5(7)6(8)10-4-2/h3H,1,4H2,2H3
InchI Key
VWBJUKIWBKFFCF-UHFFFAOYSA-N
SMILES
CCOC(=O)C(=O)OC=C
Canonical SMILES
CCOC(=O)C(=O)OC=C
Isomeric SMILES
CCOC(=O)C(=O)OC=C
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C6H8O4
Heavy Atom Count
10
Molecular Weight
144.126
Exact Molecular Weight
144.0423
Valence Electrons
56
Radical Electrons
0
tPSA
52.6
MolLogP
0.2362
H Bond Acceptors
4
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 18 17  0  0  0  0  0  0  0  0999 V2000
    3.2176    0.5613   -0.0059 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6770   -0.8316   -0.2236 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3117   -0.8474   -0.5334 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.3085   -0.3676    0.2590 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6090    0.1380    1.3696 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0714   -0.4362   -0.1634 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3800   -0.9407   -1.2734 O   0  0  0  0  0  0  0  0  0  0  0  0
   -2.1188    0.0420    0.6170 O   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4345   -0.0383    0.1834 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9782    0.9455   -0.5215 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3264    0.5238   -0.0321 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9586    0.9561    1.0192 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8924    1.2570   -0.7999 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.2443   -1.2746   -1.0681 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8610   -1.4415    0.6806 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9805   -0.9323    0.4485 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4386    1.8394   -0.7889 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.0045    0.8471   -0.8414 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  1  0
  4  5  2  0
  4  6  1  0
  6  7  2  0
  6  8  1  0
  8  9  1  0
  9 10  2  3
  1 11  1  0
  1 12  1  0
  1 13  1  0
  2 14  1  0
  2 15  1  0
  9 16  1  0
 10 17  1  0
 10 18  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers