Monomers

4-Cyanostyrene

Identifiers

IUPAC name
4-ethenylbenzonitrile
InchI
InChI=1S/C9H7N/c1-2-8-3-5-9(7-10)6-4-8/h2-6H,1H2
InchI Key
SNTUCKQYWGHZPK-UHFFFAOYSA-N
SMILES
C=Cc1ccc(cc1)C#N
Canonical SMILES
C=CC1=CC=C(C=C1)C#N
Isomeric SMILES
C=CC1=CC=C(C=C1)C#N
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C9H7N
Heavy Atom Count
10
Molecular Weight
129.162
Exact Molecular Weight
129.0578
Valence Electrons
48
Radical Electrons
0
tPSA
23.79
MolLogP
2.2013
H Bond Acceptors
1
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
1
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
1

MOL File


     RDKit          3D

 17 17  0  0  0  0  0  0  0  0999 V2000
   -0.6499    1.2972    2.7219 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4166    0.1252    2.2158 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1373   -0.0442    0.7884 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1324   -1.3161    0.2836 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3971   -1.5180   -1.0406 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4143   -0.4827   -1.9584 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1464    0.7706   -1.4517 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1252    0.9982   -0.1068 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6968   -0.7091   -3.3539 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9123   -0.8795   -4.4794 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8558    1.3954    3.7915 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6489    2.1865    2.1296 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4293   -0.7565    2.8683 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1168   -2.1218    1.0025 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6086   -2.5217   -1.4333 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.1584    1.5821   -2.1736 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3201    1.9943    0.1962 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  6  9  1  0
  9 10  3  0
  8  3  1  0
  1 11  1  0
  1 12  1  0
  2 13  1  0
  4 14  1  0
  5 15  1  0
  7 16  1  0
  8 17  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers