Monomers

1,1-Dimethyl-2-acetoxyethylene

Identifiers

IUPAC name
2-methylprop-1-enyl acetate
InchI
InChI=1S/C6H10O2/c1-5(2)4-8-6(3)7/h4H,1-3H3
InchI Key
MNJRLZXXSZEIHD-UHFFFAOYSA-N
SMILES
CC(=COC(=O)C)C
Canonical SMILES
CC(=COC(=O)C)C
Isomeric SMILES
CC(=COC(=O)C)C
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C6H10O2
Heavy Atom Count
8
Molecular Weight
114.144
Exact Molecular Weight
114.0681
Valence Electrons
46
Radical Electrons
0
tPSA
26.3
MolLogP
1.4732
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 18 17  0  0  0  0  0  0  0  0999 V2000
   -1.1292    1.3255   -0.1149 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3549   -0.1143    0.1190 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3987   -0.8689    0.5977 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8760   -0.3497    0.9089 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.8607   -0.3338   -0.0420 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5971   -0.7914   -1.1901 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.2324    0.1851    0.1697 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.6786   -0.6751   -0.1995 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9641    1.9539    0.2867 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0225    1.4897   -1.2096 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1794    1.6868    0.3373 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6060   -1.9190    0.7541 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.4241    0.9335   -0.6259 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.3819    0.6329    1.1546 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.0046   -0.6126    0.0201 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.0302   -1.3975    0.5916 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.4450    0.0886   -0.3838 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5685   -1.2336   -1.1738 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  3
  3  4  1  0
  4  5  1  0
  5  6  2  0
  5  7  1  0
  2  8  1  0
  1  9  1  0
  1 10  1  0
  1 11  1  0
  3 12  1  0
  7 13  1  0
  7 14  1  0
  7 15  1  0
  8 16  1  0
  8 17  1  0
  8 18  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers