Monomers
Ethyl vinyl ketone
Identifiers
IUPAC name
pent-1-en-3-one
InchI
InChI=1S/C5H8O/c1-3-5(6)4-2/h3H,1,4H2,2H3
InchI Key
JLIDVCMBCGBIEY-UHFFFAOYSA-N
SMILES
CCC(=O)C=C
Canonical SMILES
CCC(=O)C=C
Isomeric SMILES
CCC(=O)C=C
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C5H8O
Heavy Atom Count
6
Molecular Weight
84.118
Exact Molecular Weight
84.0575
Valence Electrons
34
Radical Electrons
0
tPSA
17.07
MolLogP
1.1515
H Bond Acceptors
1
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
14 13 0 0 0 0 0 0 0 0999 V2000
-2.1975 0.0314 -0.1124 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.8545 0.5812 -0.4782 C 0 0 0 0 0 0 0 0 0 0 0 0
0.2534 -0.1545 0.1654 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0170 -1.1151 0.9148 O 0 0 0 0 0 0 0 0 0 0 0 0
1.6342 0.2121 -0.0529 C 0 0 0 0 0 0 0 0 0 0 0 0
2.6109 -0.4574 0.5311 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.9659 0.6785 -0.5912 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.3727 -0.9887 -0.5045 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.3700 0.0643 0.9982 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8471 1.6587 -0.1528 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.7614 0.5692 -1.5741 H 0 0 0 0 0 0 0 0 0 0 0 0
1.8573 1.0460 -0.7041 H 0 0 0 0 0 0 0 0 0 0 0 0
2.3819 -1.2899 1.1809 H 0 0 0 0 0 0 0 0 0 0 0 0
3.6486 -0.1979 0.3799 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 1 0
3 4 2 0
3 5 1 0
5 6 2 3
1 7 1 0
1 8 1 0
1 9 1 0
2 10 1 0
2 11 1 0
5 12 1 0
6 13 1 0
6 14 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers