Monomers
3-Methyl-3-buten-2-one
Identifiers
IUPAC name
3-methylbut-3-en-2-one
InchI
InChI=1S/C5H8O/c1-4(2)5(3)6/h1H2,2-3H3
InchI Key
ZGHFDIIVVIFNPS-UHFFFAOYSA-N
SMILES
CC(=O)C(=C)C
Canonical SMILES
CC(=C)C(=O)C
Isomeric SMILES
CC(=C)C(=O)C
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C5H8O
Heavy Atom Count
6
Molecular Weight
84.118
Exact Molecular Weight
84.0575
Valence Electrons
34
Radical Electrons
0
tPSA
17.07
MolLogP
1.1515
H Bond Acceptors
1
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
14 13 0 0 0 0 0 0 0 0999 V2000
-1.9666 0.1040 -0.4175 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7057 -0.6424 -0.3439 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.7192 -1.8620 -0.6910 O 0 0 0 0 0 0 0 0 0 0 0 0
0.5230 -0.0093 0.1116 C 0 0 0 0 0 0 0 0 0 0 0 0
0.5008 1.2558 0.4632 C 0 0 0 0 0 0 0 0 0 0 0 0
1.8063 -0.7379 0.1955 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.8545 -0.5271 -0.5276 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.9167 0.9015 -1.1952 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.1100 0.6586 0.5558 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.4339 1.8105 0.4088 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4185 1.7278 0.8032 H 0 0 0 0 0 0 0 0 0 0 0 0
1.6953 -1.7994 0.4766 H 0 0 0 0 0 0 0 0 0 0 0 0
2.4523 -0.2682 0.9513 H 0 0 0 0 0 0 0 0 0 0 0 0
2.3105 -0.6119 -0.7907 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 2 3
4 6 1 0
1 7 1 0
1 8 1 0
1 9 1 0
5 10 1 0
5 11 1 0
6 12 1 0
6 13 1 0
6 14 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers