Monomers
2-Isocyanatoprop-1-ene
Identifiers
IUPAC name
2-isocyanatoprop-1-ene
InchI
InChI=1S/C4H5NO/c1-4(2)5-3-6/h1H2,2H3
InchI Key
UKQJZQQPMIFNHE-UHFFFAOYSA-N
SMILES
CC(=C)N=C=O
Canonical SMILES
CC(=C)N=C=O
Isomeric SMILES
CC(=C)N=C=O
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C4H5NO
Heavy Atom Count
6
Molecular Weight
83.09
Exact Molecular Weight
83.0371
Valence Electrons
32
Radical Electrons
0
tPSA
29.43
MolLogP
0.8558
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
11 10 0 0 0 0 0 0 0 0999 V2000
-0.4231 1.2807 0.2305 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2459 -0.1963 0.1360 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0559 -0.9121 1.2107 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.2865 -0.8033 -1.1257 N 0 0 0 0 0 0 0 0 0 0 0 0
0.7292 -0.7056 -1.9141 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5858 -1.1886 -2.6838 O 0 0 0 0 0 0 0 0 0 0 0 0
0.4781 1.7676 -0.2199 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.4989 1.6009 1.2948 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.3361 1.6150 -0.2688 H 0 0 0 0 0 0 0 0 0 0 0 0
0.0702 -1.9794 1.1205 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.0168 -0.4788 2.2196 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 3
2 4 1 0
4 5 2 0
5 6 2 0
1 7 1 0
1 8 1 0
1 9 1 0
3 10 1 0
3 11 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers