Monomers

2-Cyanoethyl acrylate

Identifiers

IUPAC name
2-cyanoethyl prop-2-enoate
InchI
InChI=1S/C6H7NO2/c1-2-6(8)9-5-3-4-7/h2H,1,3,5H2
InchI Key
AEPWOCLBLLCOGZ-UHFFFAOYSA-N
SMILES
C=CC(=O)OCCC#N
Canonical SMILES
C=CC(=O)OCCC#N
Isomeric SMILES
C=CC(=O)OCCC#N
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C6H7NO2
Heavy Atom Count
9
Molecular Weight
125.127
Exact Molecular Weight
125.0477
Valence Electrons
48
Radical Electrons
0
tPSA
50.09
MolLogP
0.6293
H Bond Acceptors
3
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 16 15  0  0  0  0  0  0  0  0999 V2000
    1.7017    0.8990    2.7866 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2286   -0.1077    2.0792 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7090    0.1801    0.7716 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6854    1.3721    0.2922 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.1878   -0.7151   -0.1132 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.3410   -1.0634   -1.1967 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.6392   -0.4270   -1.7320 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4404    1.0215   -1.8610 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3014    2.1539   -1.9737 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.6931    1.9129    2.3864 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0957    0.7430    3.7620 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2471   -1.0804    2.5088 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2686   -1.2300   -2.1653 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7330   -2.1843   -1.0741 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5121   -0.6580   -1.0962 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8500   -0.8166   -2.7455 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  1  0
  8  9  3  0
  1 10  1  0
  1 11  1  0
  2 12  1  0
  6 13  1  0
  6 14  1  0
  7 15  1  0
  7 16  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers