Monomers

Allyl propionate

Identifiers

IUPAC name
prop-2-enyl propanoate
InchI
InChI=1S/C6H10O2/c1-3-5-8-6(7)4-2/h3H,1,4-5H2,2H3
InchI Key
XRFWKHVQMACVTA-UHFFFAOYSA-N
SMILES
CCC(=O)OCC=C
Canonical SMILES
CCC(=O)OCC=C
Isomeric SMILES
CCC(=O)OCC=C
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C6H10O2
Heavy Atom Count
8
Molecular Weight
114.144
Exact Molecular Weight
114.0681
Valence Electrons
46
Radical Electrons
0
tPSA
26.3
MolLogP
1.1256
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 18 17  0  0  0  0  0  0  0  0999 V2000
    2.7658    0.9659   -0.3628 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0937   -0.3864   -0.4726 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6955   -0.2406    0.0273 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2517    0.8694    0.4480 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2025   -1.2845    0.0683 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5229   -1.2020    0.5268 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3684   -0.2587   -0.2045 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9370    0.7609    0.4142 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6145    0.9500    0.3559 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.1567    1.2543   -1.3595 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0787    1.7579   -0.0100 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6808   -1.0965    0.1700 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.1380   -0.8047   -1.4934 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9676   -2.2301    0.3721 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.5871   -1.0430    1.6311 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5259   -0.4031   -1.2635 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5559    1.4452   -0.1393 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.8080    0.9459    1.4735 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  1  0
  3  4  2  0
  3  5  1  0
  5  6  1  0
  6  7  1  0
  7  8  2  3
  1  9  1  0
  1 10  1  0
  1 11  1  0
  2 12  1  0
  2 13  1  0
  6 14  1  0
  6 15  1  0
  7 16  1  0
  8 17  1  0
  8 18  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers