Monomers

2,5-Norbornadiene

Identifiers

IUPAC name
bicyclo[2.2.1]hepta-2,5-diene
InchI
InChI=1S/C7H8/c1-2-7-4-3-6(1)5-7/h1-4,6-7H,5H2
InchI Key
SJYNFBVQFBRSIB-UHFFFAOYSA-N
SMILES
C1=CC2CC1C=C2
Canonical SMILES
C1C2C=CC1C=C2
Isomeric SMILES
C1C2C=CC1C=C2
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C7H8
Heavy Atom Count
7
Molecular Weight
92.141
Exact Molecular Weight
92.0626
Valence Electrons
36
Radical Electrons
0
tPSA
0.0
MolLogP
1.7485
H Bond Acceptors
0
H Bond Donors
0
Aliphatic Carbocycles
2
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
2
Aromatic Rings
0

MOL File


     RDKit          3D

 15 16  0  0  0  0  0  0  0  0999 V2000
    0.5429    1.3475   -0.1543 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3394    0.3603   -0.5622 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6531   -0.8941   -0.2090 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.1073   -0.4726    1.1717 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6249    0.7442    0.5628 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4411    0.0516   -0.4408 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6390   -0.9053   -0.9574 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7316    2.4032   -0.3257 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2940    0.4730   -1.0523 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.2108   -1.7909   -0.2067 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8966   -0.1727    1.8465 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.6210   -1.1893    1.5412 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1075    1.3616    1.2730 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.4718    0.2580   -0.7161 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.8704   -1.5745   -1.7705 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0
  2  3  1  0
  3  4  1  0
  4  5  1  0
  5  6  1  0
  6  7  2  0
  5  1  1  0
  7  3  1  0
  1  8  1  0
  2  9  1  0
  3 10  1  0
  4 11  1  0
  4 12  1  0
  5 13  1  0
  6 14  1  0
  7 15  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers