Monomers

Isobutylene

Identifiers

IUPAC name
2-methylprop-1-ene
InchI
InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3
InchI Key
VQTUBCCKSQIDNK-UHFFFAOYSA-N
SMILES
CC(=C)C
Canonical SMILES
CC(=C)C
Isomeric SMILES
CC(=C)C
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C4H8
Heavy Atom Count
4
Molecular Weight
56.108
Exact Molecular Weight
56.0626
Valence Electrons
24
Radical Electrons
0
tPSA
0.0
MolLogP
1.5824
H Bond Acceptors
0
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0

MOL File


     RDKit          3D

 12 11  0  0  0  0  0  0  0  0999 V2000
    1.3504   -0.1492    0.3910 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0527    0.1543   -0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4615    1.4024   -0.0672 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9993   -0.9795   -0.3179 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7061   -1.0441   -0.1385 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4695   -0.1927    1.4891 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.9693    0.7044    0.0435 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2230    2.1953    0.1615 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4652    1.6609   -0.3452 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4454   -1.9213   -0.3319 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4567   -0.8516   -1.3198 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8376   -0.9789    0.4354 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0
  2  3  2  3
  2  4  1  0
  1  5  1  0
  1  6  1  0
  1  7  1  0
  3  8  1  0
  3  9  1  0
  4 10  1  0
  4 11  1  0
  4 12  1  0
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers