Monomers
Isobutylene
Identifiers
IUPAC name
2-methylprop-1-ene
InchI
InChI=1S/C4H8/c1-4(2)3/h1H2,2-3H3
InchI Key
VQTUBCCKSQIDNK-UHFFFAOYSA-N
SMILES
CC(=C)C
Canonical SMILES
CC(=C)C
Isomeric SMILES
CC(=C)C
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C4H8
Heavy Atom Count
4
Molecular Weight
56.108
Exact Molecular Weight
56.0626
Valence Electrons
24
Radical Electrons
0
tPSA
0.0
MolLogP
1.5824
H Bond Acceptors
0
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
12 11 0 0 0 0 0 0 0 0999 V2000
1.3504 -0.1492 0.3910 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.0527 0.1543 -0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.4615 1.4024 -0.0672 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9993 -0.9795 -0.3179 C 0 0 0 0 0 0 0 0 0 0 0 0
1.7061 -1.0441 -0.1385 H 0 0 0 0 0 0 0 0 0 0 0 0
1.4695 -0.1927 1.4891 H 0 0 0 0 0 0 0 0 0 0 0 0
1.9693 0.7044 0.0435 H 0 0 0 0 0 0 0 0 0 0 0 0
0.2230 2.1953 0.1615 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4652 1.6609 -0.3452 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.4454 -1.9213 -0.3319 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.4567 -0.8516 -1.3198 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.8376 -0.9789 0.4354 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 3
2 4 1 0
1 5 1 0
1 6 1 0
1 7 1 0
3 8 1 0
3 9 1 0
4 10 1 0
4 11 1 0
4 12 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers