Monomers
1-(2-Chlorophenyl)-1H-pyrrole-2,5-dione
Identifiers
IUPAC name
1-(2-chlorophenyl)pyrrole-2,5-dione
InchI
InChI=1S/C10H6ClNO2/c11-7-3-1-2-4-8(7)12-9(13)5-6-10(12)14/h1-6H
InchI Key
KPQOXMCRYWDRSB-UHFFFAOYSA-N
SMILES
O=C1C=CC(=O)N1c1ccccc1Cl
Canonical SMILES
C1=CC=C(C(=C1)N2C(=O)C=CC2=O)Cl
Isomeric SMILES
C1=CC=C(C(=C1)N2C(=O)C=CC2=O)Cl
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C10H6ClNO2
Heavy Atom Count
14
Molecular Weight
207.616
Exact Molecular Weight
207.0087
Valence Electrons
70
Radical Electrons
0
tPSA
37.38
MolLogP
1.7694
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
1
Aliphatic Heterocycles
1
Aromatic Heterocycles
0
Aliphatic Rings
1
Aromatic Rings
1
MOL File
RDKit 3D
20 21 0 0 0 0 0 0 0 0999 V2000
1.7523 -2.0809 -0.6039 O 0 0 0 0 0 0 0 0 0 0 0 0
1.8883 -1.0004 0.0261 C 0 0 0 0 0 0 0 0 0 0 0 0
3.1439 -0.5725 0.6283 C 0 0 0 0 0 0 0 0 0 0 0 0
2.9470 0.6036 1.2127 C 0 0 0 0 0 0 0 0 0 0 0 0
1.5625 1.0340 1.0412 C 0 0 0 0 0 0 0 0 0 0 0 0
1.0836 2.1223 1.4947 O 0 0 0 0 0 0 0 0 0 0 0 0
0.9261 0.0181 0.2997 N 0 0 0 0 0 0 0 0 0 0 0 0
-0.4146 -0.0106 -0.1084 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.2170 -1.1194 0.1506 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.5276 -1.1471 -0.2487 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.0764 -0.0858 -0.9106 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.2633 0.9998 -1.1554 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.9415 1.0763 -0.7751 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0266 2.5132 -1.1336 Cl 0 0 0 0 0 0 0 0 0 0 0 0
4.0791 -1.1511 0.5872 H 0 0 0 0 0 0 0 0 0 0 0 0
3.7520 1.1177 1.7297 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.8118 -1.9799 0.6743 H 0 0 0 0 0 0 0 0 0 0 0 0
-3.1117 -2.0437 -0.0194 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.1156 -0.1411 -1.2119 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.6821 1.8473 -1.6777 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 0
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
5 7 1 0
7 8 1 0
8 9 2 0
9 10 1 0
10 11 2 0
11 12 1 0
12 13 2 0
13 14 1 0
7 2 1 0
13 8 1 0
3 15 1 0
4 16 1 0
9 17 1 0
10 18 1 0
11 19 1 0
12 20 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers