Monomers
4-Ethenylbenzene-1-thiol
Identifiers
IUPAC name
4-ethenylbenzenethiol
InchI
InChI=1S/C8H8S/c1-2-7-3-5-8(9)6-4-7/h2-6,9H,1H2
InchI Key
KCCWFTFCEHVSTM-UHFFFAOYSA-N
SMILES
C=Cc1ccc(cc1)S
Canonical SMILES
C=CC1=CC=C(C=C1)S
Isomeric SMILES
C=CC1=CC=C(C=C1)S
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C8H8S
Heavy Atom Count
9
Molecular Weight
136.219
Exact Molecular Weight
136.0347
Valence Electrons
46
Radical Electrons
0
tPSA
0.0
MolLogP
2.6183
H Bond Acceptors
1
H Bond Donors
1
Aliphatic Carbocycles
0
Aromatic Carbocycles
1
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
1
MOL File
RDKit 3D
17 17 0 0 0 0 0 0 0 0999 V2000
3.0320 -0.7332 -0.1578 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2222 0.2708 0.1290 C 0 0 0 0 0 0 0 0 0 0 0 0
0.7678 0.2089 0.0385 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0694 -0.9067 -0.3576 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3222 -0.8927 -0.4204 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.0547 0.2288 -0.0916 C 0 0 0 0 0 0 0 0 0 0 0 0
-1.3513 1.3465 0.3053 C 0 0 0 0 0 0 0 0 0 0 0 0
0.0327 1.3262 0.3657 C 0 0 0 0 0 0 0 0 0 0 0 0
-3.8475 0.2480 -0.1722 S 0 0 0 0 0 0 0 0 0 0 0 0
2.6014 -1.6697 -0.4827 H 0 0 0 0 0 0 0 0 0 0 0 0
4.0939 -0.6862 -0.0911 H 0 0 0 0 0 0 0 0 0 0 0 0
2.7271 1.1898 0.4518 H 0 0 0 0 0 0 0 0 0 0 0 0
0.6003 -1.8068 -0.6241 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.8774 -1.7734 -0.7332 H 0 0 0 0 0 0 0 0 0 0 0 0
-1.8806 2.2487 0.5726 H 0 0 0 0 0 0 0 0 0 0 0 0
0.5867 2.2136 0.6806 H 0 0 0 0 0 0 0 0 0 0 0 0
-4.3998 -0.8124 0.5874 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 2 3
2 3 1 0
3 4 2 0
4 5 1 0
5 6 2 0
6 7 1 0
7 8 2 0
6 9 1 0
8 3 1 0
1 10 1 0
1 11 1 0
2 12 1 0
4 13 1 0
5 14 1 0
7 15 1 0
8 16 1 0
9 17 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers