Monomers

3-Nitrostyrene

Identifiers

IUPAC name
1-ethenyl-3-nitrobenzene
InchI
InChI=1S/C8H7NO2/c1-2-7-4-3-5-8(6-7)9(10)11/h2-6H,1H2
InchI Key
SYZVQXIUVGKCBJ-UHFFFAOYSA-N
SMILES
C=Cc1cccc(c1)[N+](=O)[O-]
Canonical SMILES
C=CC1=CC(=CC=C1)[N+](=O)[O-]
Isomeric SMILES
C=CC1=CC(=CC=C1)[N+](=O)[O-]
Resources

Structures

2D Structure
3D Structure

Molecular Formula and Computed Descriptors

Molecular Formula
C8H7NO2
Heavy Atom Count
11
Molecular Weight
149.149
Exact Molecular Weight
149.0477
Valence Electrons
56
Radical Electrons
0
tPSA
43.14
MolLogP
2.2378
H Bond Acceptors
2
H Bond Donors
0
Aliphatic Carbocycles
0
Aromatic Carbocycles
1
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
1

MOL File


     RDKit          3D

 18 18  0  0  0  0  0  0  0  0999 V2000
    2.7887    1.0714   -0.2133 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2471   -0.1260   -0.2605 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8181   -0.3431   -0.1047 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3330   -1.6450   -0.1688 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.0029   -1.9550   -0.0333 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8597   -0.8932    0.1736 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4406    0.4073    0.2457 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0807    0.6658    0.1024 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3283    1.4939    0.4588 N   0  0  0  0  0  4  0  0  0  0  0  0
   -3.5417    1.2476    0.5853 O   0  0  0  0  0  0  0  0  0  0  0  0
   -1.8799    2.7866    0.5265 O   0  0  0  0  0  1  0  0  0  0  0  0
    2.1800    1.9233   -0.0569 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8569    1.1933   -0.3336 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9189   -0.9911   -0.4260 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0391   -2.4640   -0.3340 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.3594   -2.9901   -0.0879 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9154   -1.0893    0.2853 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.2267    1.7076    0.1636 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  3
  2  3  1  0
  3  4  2  0
  4  5  1  0
  5  6  2  0
  6  7  1  0
  7  8  2  0
  7  9  1  0
  9 10  2  0
  9 11  1  0
  8  3  1  0
  1 12  1  0
  1 13  1  0
  2 14  1  0
  4 15  1  0
  5 16  1  0
  6 17  1  0
  8 18  1  0
M  CHG  2   9   1  11  -1
M  END

Similar Monomers

Structure
Similarity
IUPAC name
MF
Copolymers