Monomers
N-Vinylacetamide
Identifiers
IUPAC name
N-ethenylacetamide
InchI
InChI=1S/C4H7NO/c1-3-5-4(2)6/h3H,1H2,2H3,(H,5,6)
InchI Key
RQAKESSLMFZVMC-UHFFFAOYSA-N
SMILES
CC(=O)NC=C
Canonical SMILES
CC(=O)NC=C
Isomeric SMILES
CC(=O)NC=C
Structures
2D Structure
3D Structure
Molecular Formula and Computed Descriptors
Molecular Formula
C4H7NO
Heavy Atom Count
6
Molecular Weight
85.106
Exact Molecular Weight
85.0528
Valence Electrons
34
Radical Electrons
0
tPSA
29.1
MolLogP
0.266
H Bond Acceptors
1
H Bond Donors
1
Aliphatic Carbocycles
0
Aromatic Carbocycles
0
Aliphatic Heterocycles
0
Aromatic Heterocycles
0
Aliphatic Rings
0
Aromatic Rings
0
MOL File
RDKit 3D
13 12 0 0 0 0 0 0 0 0999 V2000
-2.1626 -0.0941 0.4890 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.6652 0.1398 0.4134 C 0 0 0 0 0 0 0 0 0 0 0 0
-0.1489 0.8159 1.3006 O 0 0 0 0 0 0 0 0 0 0 0 0
0.0759 -0.4055 -0.6379 N 0 0 0 0 0 0 0 0 0 0 0 0
1.4533 -0.2328 -0.7727 C 0 0 0 0 0 0 0 0 0 0 0 0
2.2260 0.4268 0.0148 C 0 0 0 0 0 0 0 0 0 0 0 0
-2.6622 0.8516 0.1949 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.3677 -0.2756 1.5531 H 0 0 0 0 0 0 0 0 0 0 0 0
-2.4572 -0.9270 -0.1744 H 0 0 0 0 0 0 0 0 0 0 0 0
-0.4564 -0.9972 -1.3911 H 0 0 0 0 0 0 0 0 0 0 0 0
1.9244 -0.7303 -1.6723 H 0 0 0 0 0 0 0 0 0 0 0 0
1.9265 0.9358 0.8825 H 0 0 0 0 0 0 0 0 0 0 0 0
3.3140 0.4927 -0.1997 H 0 0 0 0 0 0 0 0 0 0 0 0
1 2 1 0
2 3 2 0
2 4 1 0
4 5 1 0
5 6 2 3
1 7 1 0
1 8 1 0
1 9 1 0
4 10 1 0
5 11 1 0
6 12 1 0
6 13 1 0
M END
Similar Monomers
Structure
Similarity
IUPAC name
MF
Copolymers